About 12-methoxyoctadecan-1-ol
12-methoxyoctadecan-1-ol (PubChem CID 18347175) has the molecular formula C19H40O2
and a molecular weight of 300.53 g/mol. Its IUPAC name is 12-methoxyoctadecan-1-ol.
Molecular Properties
| Compound Name | 12-methoxyoctadecan-1-ol |
| PubChem CID | 18347175 |
| Molecular Formula | C19H40O2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.30 |
| IUPAC Name | 12-methoxyoctadecan-1-ol |
| SMILES | CCCCCCC(CCCCCCCCCCCO)OC |
| InChI | InChI=1S/C19H40O2/c1-3-4-5-13-16-19(21-2)17-14-11-9-7-6-8-10-12-15-18-20/h19-20H,3-18H2,1-2H3 |
| InChIKey | UFBXWTNOEZDSEN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-methoxyoctadecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methoxyoctadecan-1-ol?
The IUPAC name of 12-methoxyoctadecan-1-ol (CID 18347175) is 12-methoxyoctadecan-1-ol.
What is the SMILES notation for 12-methoxyoctadecan-1-ol?
The canonical SMILES for 12-methoxyoctadecan-1-ol is CCCCCCC(CCCCCCCCCCCO)OC.
What is the InChIKey of 12-methoxyoctadecan-1-ol?
The InChIKey is UFBXWTNOEZDSEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O2/c1-3-4-5-13-16-19(21-2)17-14-11-9-7-6-8-10-12-15-18-20/h19-20H,3-18H2,1-2H3.
What are the key properties of 12-methoxyoctadecan-1-ol?
12-methoxyoctadecan-1-ol has a molecular weight of 300.53 g/mol, XLogP of 5.87, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methoxyoctadecan-1-ol is sourced from PubChem (CID 18347175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).