About (Z,9S)-9-hydroxydec-5-enal
(Z,9S)-9-hydroxydec-5-enal (PubChem CID 11041152) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (Z,9S)-9-hydroxydec-5-enal.
Molecular Properties
| Compound Name | (Z,9S)-9-hydroxydec-5-enal |
| PubChem CID | 11041152 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (Z,9S)-9-hydroxydec-5-enal |
| SMILES | C[C@H](O)CC/C=C\CCCC=O |
| InChI | InChI=1S/C10H18O2/c1-10(12)8-6-4-2-3-5-7-9-11/h2,4,9-10,12H,3,5-8H2,1H3/b4-2-/t10-/m0/s1 |
| InChIKey | XEOHMCDMXCHRSU-GQPNGRKGSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,9S)-9-hydroxydec-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,9S)-9-hydroxydec-5-enal?
The IUPAC name of (Z,9S)-9-hydroxydec-5-enal (CID 11041152) is (Z,9S)-9-hydroxydec-5-enal.
What is the SMILES notation for (Z,9S)-9-hydroxydec-5-enal?
The canonical SMILES for (Z,9S)-9-hydroxydec-5-enal is C[C@H](O)CC/C=C\CCCC=O.
What is the InChIKey of (Z,9S)-9-hydroxydec-5-enal?
The InChIKey is XEOHMCDMXCHRSU-GQPNGRKGSA-N. The full InChI is InChI=1S/C10H18O2/c1-10(12)8-6-4-2-3-5-7-9-11/h2,4,9-10,12H,3,5-8H2,1H3/b4-2-/t10-/m0/s1.
What are the key properties of (Z,9S)-9-hydroxydec-5-enal?
(Z,9S)-9-hydroxydec-5-enal has a molecular weight of 170.25 g/mol, XLogP of 2.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,9S)-9-hydroxydec-5-enal is sourced from PubChem (CID 11041152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).