About tetracos-5-en-2-ol
tetracos-5-en-2-ol (PubChem CID 173208999) has the molecular formula C24H48O
and a molecular weight of 352.65 g/mol. Its IUPAC name is tetracos-5-en-2-ol.
Molecular Properties
| Compound Name | tetracos-5-en-2-ol |
| PubChem CID | 173208999 |
| Molecular Formula | C24H48O |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.37 |
| IUPAC Name | tetracos-5-en-2-ol |
| SMILES | CCCCCCCCCCCCCCCCCCC=CCCC(C)O |
| InChI | InChI=1S/C24H48O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(2)25/h20-21,24-25H,3-19,22-23H2,1-2H3 |
| InChIKey | DLKSCWMNDHRNGH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tetracos-5-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracos-5-en-2-ol?
The IUPAC name of tetracos-5-en-2-ol (CID 173208999) is tetracos-5-en-2-ol.
What is the SMILES notation for tetracos-5-en-2-ol?
The canonical SMILES for tetracos-5-en-2-ol is CCCCCCCCCCCCCCCCCCC=CCCC(C)O.
What is the InChIKey of tetracos-5-en-2-ol?
The InChIKey is DLKSCWMNDHRNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(2)25/h20-21,24-25H,3-19,22-23H2,1-2H3.
What are the key properties of tetracos-5-en-2-ol?
tetracos-5-en-2-ol has a molecular weight of 352.65 g/mol, XLogP of 8.36, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracos-5-en-2-ol is sourced from PubChem (CID 173208999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).