About (E)-dodec-5-en-2-ol
(E)-dodec-5-en-2-ol (PubChem CID 10511710) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is (E)-dodec-5-en-2-ol.
Molecular Properties
| Compound Name | (E)-dodec-5-en-2-ol |
| PubChem CID | 10511710 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (E)-dodec-5-en-2-ol |
| SMILES | CCCCCC/C=C/CCC(C)O |
| InChI | InChI=1S/C12H24O/c1-3-4-5-6-7-8-9-10-11-12(2)13/h8-9,12-13H,3-7,10-11H2,1-2H3/b9-8+ |
| InChIKey | MCRCRUDECZPBRK-CMDGGOBGSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-dodec-5-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-dodec-5-en-2-ol?
The IUPAC name of (E)-dodec-5-en-2-ol (CID 10511710) is (E)-dodec-5-en-2-ol.
What is the SMILES notation for (E)-dodec-5-en-2-ol?
The canonical SMILES for (E)-dodec-5-en-2-ol is CCCCCC/C=C/CCC(C)O.
What is the InChIKey of (E)-dodec-5-en-2-ol?
The InChIKey is MCRCRUDECZPBRK-CMDGGOBGSA-N. The full InChI is InChI=1S/C12H24O/c1-3-4-5-6-7-8-9-10-11-12(2)13/h8-9,12-13H,3-7,10-11H2,1-2H3/b9-8+.
What are the key properties of (E)-dodec-5-en-2-ol?
(E)-dodec-5-en-2-ol has a molecular weight of 184.32 g/mol, XLogP of 3.67, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-dodec-5-en-2-ol is sourced from PubChem (CID 10511710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).