7-hydroxyoct-3-enoic acid

C8H14O3 — CID 85299253

IUPAC7-hydroxyoct-3-enoic acid
SMILESCC(O)CCC=CCC(=O)O
InChIInChI=1S/C8H14O3/c1-7(9)5-3-2-4-6-8(10)11/h2,4,7,9H,3,5-6H2,1H3,(H,10,11)
InChIKeyMHPNQJXSEAYFKP-UHFFFAOYSA-N
MW158.20 g/mol
LogP1.18
Rot. Bonds5

About 7-hydroxyoct-3-enoic acid

7-hydroxyoct-3-enoic acid (PubChem CID 85299253) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 7-hydroxyoct-3-enoic acid.

Molecular Properties

Compound Name7-hydroxyoct-3-enoic acid
PubChem CID85299253
Molecular FormulaC8H14O3
Molecular Weight158.20 g/mol
Exact Mass158.09
IUPAC Name7-hydroxyoct-3-enoic acid
SMILESCC(O)CCC=CCC(=O)O
InChIInChI=1S/C8H14O3/c1-7(9)5-3-2-4-6-8(10)11/h2,4,7,9H,3,5-6H2,1H3,(H,10,11)
InChIKeyMHPNQJXSEAYFKP-UHFFFAOYSA-N
XLogP1.18
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.20
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 7-hydroxyoct-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(E,7R,8S)-8-hydroxy-7,9-dimethyldec-3-enoic acid
CID 88891643
7-aminonon-3-enedioic acid
CID 175407467
(Z,9S)-9-hydroxydec-5-enal
CID 11041152
11-hydroxydodec-6-enoic acid
CID 123616769
(E)-6-hydroxyhept-2-enal
CID 102460202
(E)-6-aminohex-3-enoic acid
CID 19017972
docosa-3,6,9,12,15,18-hexaenoic acid
CID 57358010
(E)-7,7-dimethyloct-3-enoic acid
CID 155169121
oct-3-enedioic acid
CID 162155605
CID 59767666
CID 59767666
(3E)-octa-3,7-dienoic acid
CID 12688314
octa-3,7-dienoic acid
CID 71318533

Frequently Asked Questions

What is the IUPAC name of 7-hydroxyoct-3-enoic acid?
The IUPAC name of 7-hydroxyoct-3-enoic acid (CID 85299253) is 7-hydroxyoct-3-enoic acid.
What is the SMILES notation for 7-hydroxyoct-3-enoic acid?
The canonical SMILES for 7-hydroxyoct-3-enoic acid is CC(O)CCC=CCC(=O)O.
What is the InChIKey of 7-hydroxyoct-3-enoic acid?
The InChIKey is MHPNQJXSEAYFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-7(9)5-3-2-4-6-8(10)11/h2,4,7,9H,3,5-6H2,1H3,(H,10,11).
What are the key properties of 7-hydroxyoct-3-enoic acid?
7-hydroxyoct-3-enoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyoct-3-enoic acid is sourced from PubChem (CID 85299253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).