About 7-aminonon-3-enedioic acid
7-aminonon-3-enedioic acid (PubChem CID 175407467) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is 7-aminonon-3-enedioic acid.
Molecular Properties
| Compound Name | 7-aminonon-3-enedioic acid |
| PubChem CID | 175407467 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 7-aminonon-3-enedioic acid |
| SMILES | NC(CCC=CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C9H15NO4/c10-7(6-9(13)14)4-2-1-3-5-8(11)12/h1,3,7H,2,4-6,10H2,(H,11,12)(H,13,14) |
| InChIKey | SRITVQLVBFSAAT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-aminonon-3-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminonon-3-enedioic acid?
The IUPAC name of 7-aminonon-3-enedioic acid (CID 175407467) is 7-aminonon-3-enedioic acid.
What is the SMILES notation for 7-aminonon-3-enedioic acid?
The canonical SMILES for 7-aminonon-3-enedioic acid is NC(CCC=CCC(=O)O)CC(=O)O.
What is the InChIKey of 7-aminonon-3-enedioic acid?
The InChIKey is SRITVQLVBFSAAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c10-7(6-9(13)14)4-2-1-3-5-8(11)12/h1,3,7H,2,4-6,10H2,(H,11,12)(H,13,14).
What are the key properties of 7-aminonon-3-enedioic acid?
7-aminonon-3-enedioic acid has a molecular weight of 201.22 g/mol, XLogP of 0.60, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminonon-3-enedioic acid is sourced from PubChem (CID 175407467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).