(E)-6-aminooct-3-enoic acid

C8H15NO2 — CID 169196250

IUPAC(E)-6-aminooct-3-enoic acid
SMILESCCC(N)C/C=C/CC(=O)O
InChIInChI=1S/C8H15NO2/c1-2-7(9)5-3-4-6-8(10)11/h3-4,7H,2,5-6,9H2,1H3,(H,10,11)/b4-3+
InChIKeyAABICRQDAVLMAZ-ONEGZZNKSA-N
MW157.21 g/mol
LogP1.14
Rot. Bonds5

About (E)-6-aminooct-3-enoic acid

(E)-6-aminooct-3-enoic acid (PubChem CID 169196250) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (E)-6-aminooct-3-enoic acid.

Molecular Properties

Compound Name(E)-6-aminooct-3-enoic acid
PubChem CID169196250
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name(E)-6-aminooct-3-enoic acid
SMILESCCC(N)C/C=C/CC(=O)O
InChIInChI=1S/C8H15NO2/c1-2-7(9)5-3-4-6-8(10)11/h3-4,7H,2,5-6,9H2,1H3,(H,10,11)/b4-3+
InChIKeyAABICRQDAVLMAZ-ONEGZZNKSA-N
XLogP1.14
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-6-aminooct-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-6-aminooct-3-enoic acid?
The IUPAC name of (E)-6-aminooct-3-enoic acid (CID 169196250) is (E)-6-aminooct-3-enoic acid.
What is the SMILES notation for (E)-6-aminooct-3-enoic acid?
The canonical SMILES for (E)-6-aminooct-3-enoic acid is CCC(N)C/C=C/CC(=O)O.
What is the InChIKey of (E)-6-aminooct-3-enoic acid?
The InChIKey is AABICRQDAVLMAZ-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-7(9)5-3-4-6-8(10)11/h3-4,7H,2,5-6,9H2,1H3,(H,10,11)/b4-3+.
What are the key properties of (E)-6-aminooct-3-enoic acid?
(E)-6-aminooct-3-enoic acid has a molecular weight of 157.21 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-aminooct-3-enoic acid is sourced from PubChem (CID 169196250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).