About ethane;methylcyclopropane;(Z)-oct-5-en-3-amine
ethane;methylcyclopropane;(Z)-oct-5-en-3-amine (PubChem CID 144829616) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is ethane;methylcyclopropane;(Z)-oct-5-en-3-amine.
Molecular Properties
| Compound Name | ethane;methylcyclopropane;(Z)-oct-5-en-3-amine |
| PubChem CID | 144829616 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | ethane;methylcyclopropane;(Z)-oct-5-en-3-amine |
| SMILES | CC.CC/C=C\CC(N)CC.CC1CC1 |
| InChI | InChI=1S/C8H17N.C4H8.C2H6/c1-3-5-6-7-8(9)4-2;1-4-2-3-4;1-2/h5-6,8H,3-4,7,9H2,1-2H3;4H,2-3H2,1H3;1-2H3/b6-5-;; |
| InChIKey | NONQLKOMVJKTJH-XNOMRPDFSA-N |
| XLogP | 4.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methylcyclopropane;(Z)-oct-5-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylcyclopropane;(Z)-oct-5-en-3-amine?
The IUPAC name of ethane;methylcyclopropane;(Z)-oct-5-en-3-amine (CID 144829616) is ethane;methylcyclopropane;(Z)-oct-5-en-3-amine.
What is the SMILES notation for ethane;methylcyclopropane;(Z)-oct-5-en-3-amine?
The canonical SMILES for ethane;methylcyclopropane;(Z)-oct-5-en-3-amine is CC.CC/C=C\CC(N)CC.CC1CC1.
What is the InChIKey of ethane;methylcyclopropane;(Z)-oct-5-en-3-amine?
The InChIKey is NONQLKOMVJKTJH-XNOMRPDFSA-N. The full InChI is InChI=1S/C8H17N.C4H8.C2H6/c1-3-5-6-7-8(9)4-2;1-4-2-3-4;1-2/h5-6,8H,3-4,7,9H2,1-2H3;4H,2-3H2,1H3;1-2H3/b6-5-;;.
What are the key properties of ethane;methylcyclopropane;(Z)-oct-5-en-3-amine?
ethane;methylcyclopropane;(Z)-oct-5-en-3-amine has a molecular weight of 213.41 g/mol, XLogP of 4.52, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylcyclopropane;(Z)-oct-5-en-3-amine is sourced from PubChem (CID 144829616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).