C12H21N — CID 154605430
(2E,6Z)-1-cyclopropylnona-2,6-dien-1-amine (PubChem CID 154605430) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E,6Z)-1-cyclopropylnona-2,6-dien-1-amine.
| Compound Name | (2E,6Z)-1-cyclopropylnona-2,6-dien-1-amine |
|---|---|
| PubChem CID | 154605430 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E,6Z)-1-cyclopropylnona-2,6-dien-1-amine |
| SMILES | CC/C=C\CC/C=C/C(N)C1CC1 |
| InChI | InChI=1S/C12H21N/c1-2-3-4-5-6-7-8-12(13)11-9-10-11/h3-4,7-8,11-12H,2,5-6,9-10,13H2,1H3/b4-3-,8-7+ |
| InChIKey | UYKGEVUGFMJZKQ-ODYTWBPASA-N |
| XLogP | 3.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|