About (E)-6-oxohept-3-enedioic acid
(E)-6-oxohept-3-enedioic acid (PubChem CID 15386024) has the molecular formula C7H8O5
and a molecular weight of 172.14 g/mol. Its IUPAC name is (E)-6-oxohept-3-enedioic acid.
Molecular Properties
| Compound Name | (E)-6-oxohept-3-enedioic acid |
| PubChem CID | 15386024 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (E)-6-oxohept-3-enedioic acid |
| SMILES | O=C(O)C/C=C/CC(=O)C(=O)O |
| InChI | InChI=1S/C7H8O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,9,10)(H,11,12)/b2-1+ |
| InChIKey | ICGKEQXHPZUYSF-OWOJBTEDSA-N |
| XLogP | 0.06 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-oxohept-3-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-oxohept-3-enedioic acid?
The IUPAC name of (E)-6-oxohept-3-enedioic acid (CID 15386024) is (E)-6-oxohept-3-enedioic acid.
What is the SMILES notation for (E)-6-oxohept-3-enedioic acid?
The canonical SMILES for (E)-6-oxohept-3-enedioic acid is O=C(O)C/C=C/CC(=O)C(=O)O.
What is the InChIKey of (E)-6-oxohept-3-enedioic acid?
The InChIKey is ICGKEQXHPZUYSF-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H8O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,9,10)(H,11,12)/b2-1+.
What are the key properties of (E)-6-oxohept-3-enedioic acid?
(E)-6-oxohept-3-enedioic acid has a molecular weight of 172.14 g/mol, XLogP of 0.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-oxohept-3-enedioic acid is sourced from PubChem (CID 15386024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).