C17H26O4 — CID 54247799
6-nona-3,6-dienoyloxyoct-3-enoic acid (PubChem CID 54247799) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 6-nona-3,6-dienoyloxyoct-3-enoic acid.
| Compound Name | 6-nona-3,6-dienoyloxyoct-3-enoic acid |
|---|---|
| PubChem CID | 54247799 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 6-nona-3,6-dienoyloxyoct-3-enoic acid |
| SMILES | CCC=CCC=CCC(=O)OC(CC)CC=CCC(=O)O |
| InChI | InChI=1S/C17H26O4/c1-3-5-6-7-8-9-14-17(20)21-15(4-2)12-10-11-13-16(18)19/h5-6,8-11,15H,3-4,7,12-14H2,1-2H3,(H,18,19) |
| InChIKey | QUNPPQPBDWADFF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|