C34H56O4 — CID 138233746
8-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxyhexadecanoic acid (PubChem CID 138233746) has the molecular formula C34H56O4 and a molecular weight of 528.82 g/mol. Its IUPAC name is 8-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxyhexadecanoic acid.
| Compound Name | 8-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxyhexadecanoic acid |
|---|---|
| PubChem CID | 138233746 |
| Molecular Formula | C34H56O4 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | 8-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoyl]oxyhexadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OC(CCCCCCCC)CCCCCCC(=O)O |
| InChI | InChI=1S/C34H56O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-27-31-34(37)38-32(28-24-20-10-8-6-4-2)29-25-22-23-26-30-33(35)36/h5,7,11-12,14-15,17-18,21,27,32H,3-4,6,8-10,13,16,19-20,22-26,28-31H2,1-2H3,(H,35,36)/b7-5-,12-11-,15-14-,18-17-,27-21- |
| InChIKey | PCMYDDRPXTUJOA-CYXALAPMSA-N |
| XLogP | 10.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|