C38H64O4 — CID 134746949
9-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxyhexadecanoic acid (PubChem CID 134746949) has the molecular formula C38H64O4 and a molecular weight of 584.93 g/mol. Its IUPAC name is 9-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxyhexadecanoic acid.
| Compound Name | 9-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxyhexadecanoic acid |
|---|---|
| PubChem CID | 134746949 |
| Molecular Formula | C38H64O4 |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 584.48 |
| IUPAC Name | 9-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxyhexadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(CCCCCCC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C38H64O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-31-35-38(41)42-36(32-28-24-8-6-4-2)33-29-25-23-26-30-34-37(39)40/h5,7,10-11,13-14,16-17,19-20,36H,3-4,6,8-9,12,15,18,21-35H2,1-2H3,(H,39,40)/b7-5-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | LKIQLQCCFNDEDF-GJCLIZKUSA-N |
| XLogP | 11.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|