C34H58O4 — CID 138243685
7-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxydodecanoic acid (PubChem CID 138243685) has the molecular formula C34H58O4 and a molecular weight of 530.83 g/mol. Its IUPAC name is 7-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxydodecanoic acid.
| Compound Name | 7-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxydodecanoic acid |
|---|---|
| PubChem CID | 138243685 |
| Molecular Formula | C34H58O4 |
| Molecular Weight | 530.83 g/mol |
| Exact Mass | 530.43 |
| IUPAC Name | 7-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoyl]oxydodecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(CCCCC)CCCCCC(=O)O |
| InChI | InChI=1S/C34H58O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-31-34(37)38-32(28-24-6-4-2)29-25-23-26-30-33(35)36/h5,7,9-10,12-13,15-16,32H,3-4,6,8,11,14,17-31H2,1-2H3,(H,35,36)/b7-5-,10-9-,13-12-,16-15- |
| InChIKey | QGZJFZFZJGLMNJ-KUXGPOOQSA-N |
| XLogP | 10.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.83 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|