C35H62O4 — CID 134740070
11-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyheptadecanoic acid (PubChem CID 134740070) has the molecular formula C35H62O4 and a molecular weight of 546.88 g/mol. Its IUPAC name is 11-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyheptadecanoic acid.
| Compound Name | 11-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyheptadecanoic acid |
|---|---|
| PubChem CID | 134740070 |
| Molecular Formula | C35H62O4 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | 11-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxyheptadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CCCCCC)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C35H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-21-24-28-32-35(38)39-33(29-25-8-6-4-2)30-26-22-19-18-20-23-27-31-34(36)37/h5,7,10-11,13-14,33H,3-4,6,8-9,12,15-32H2,1-2H3,(H,36,37)/b7-5-,11-10-,14-13- |
| InChIKey | IZLWFXZKOUNNTJ-LNCSVHMCSA-N |
| XLogP | 11.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|