C15H26O2 — CID 155014233
2-methylpentan-3-yl (3Z,6Z)-nona-3,6-dienoate (PubChem CID 155014233) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-methylpentan-3-yl (3Z,6Z)-nona-3,6-dienoate.
| Compound Name | 2-methylpentan-3-yl (3Z,6Z)-nona-3,6-dienoate |
|---|---|
| PubChem CID | 155014233 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-methylpentan-3-yl (3Z,6Z)-nona-3,6-dienoate |
| SMILES | CC/C=C\C/C=C\CC(=O)OC(CC)C(C)C |
| InChI | InChI=1S/C15H26O2/c1-5-7-8-9-10-11-12-15(16)17-14(6-2)13(3)4/h7-8,10-11,13-14H,5-6,9,12H2,1-4H3/b8-7-,11-10- |
| InChIKey | NADKIBJXDANIFW-NQLNTKRDSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|