C25H40O4 — CID 138310166
5-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyheptanoic acid (PubChem CID 138310166) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 5-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyheptanoic acid.
| Compound Name | 5-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyheptanoic acid |
|---|---|
| PubChem CID | 138310166 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 5-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyheptanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(CC)CCCC(=O)O |
| InChI | InChI=1S/C25H40O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25(28)29-23(4-2)20-19-21-24(26)27/h5-6,8-9,11-12,14-15,23H,3-4,7,10,13,16-22H2,1-2H3,(H,26,27)/b6-5-,9-8-,12-11-,15-14- |
| InChIKey | YYVDQYDXDTVPTF-AFSLFLIVSA-N |
| XLogP | 6.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|