C44H70O4 — CID 138176558
(14Z,17Z,20Z,23Z)-9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexacosa-14,17,20,23-tetraenoic acid (PubChem CID 138176558) has the molecular formula C44H70O4 and a molecular weight of 663.04 g/mol. Its IUPAC name is (14Z,17Z,20Z,23Z)-9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexacosa-14,17,20,23-tetraenoic acid.
| Compound Name | (14Z,17Z,20Z,23Z)-9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexacosa-14,17,20,23-tetraenoic acid |
|---|---|
| PubChem CID | 138176558 |
| Molecular Formula | C44H70O4 |
| Molecular Weight | 663.04 g/mol |
| Exact Mass | 662.53 |
| IUPAC Name | (14Z,17Z,20Z,23Z)-9-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxyhexacosa-14,17,20,23-tetraenoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(CCCC/C=C\C/C=C\C/C=C\C/C=C\CC)CCCCCCCC(=O)O |
| InChI | InChI=1S/C44H70O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-30-34-38-42(39-35-31-29-32-36-40-43(45)46)48-44(47)41-37-33-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23-26,42H,3-4,9-10,15-16,21-22,27-41H2,1-2H3,(H,45,46)/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18-,25-23-,26-24- |
| InChIKey | IGPJGFRJIXEJQN-CKKCRWTASA-N |
| XLogP | 13.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.04 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|