C12H28N4O4 — CID 87126167
(3R)-3,6-diaminohexanoic acid;3,6-diaminohexanoic acid (PubChem CID 87126167) has the molecular formula C12H28N4O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3R)-3,6-diaminohexanoic acid;3,6-diaminohexanoic acid.
| Compound Name | (3R)-3,6-diaminohexanoic acid;3,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 87126167 |
| Molecular Formula | C12H28N4O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | (3R)-3,6-diaminohexanoic acid;3,6-diaminohexanoic acid |
| SMILES | NCCCC(N)CC(=O)O.NCCC[C@@H](N)CC(=O)O |
| InChI | InChI=1S/2C6H14N2O2/c2*7-3-1-2-5(8)4-6(9)10/h2*5H,1-4,7-8H2,(H,9,10)/t5-;/m1./s1 |
| InChIKey | RVCGLCXETYWGNN-NUBCRITNSA-N |
| XLogP | -0.95 |
| TPSA | 178.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |