C7H17N3O — CID 165481888
(3S)-3,7-diaminoheptanamide (PubChem CID 165481888) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is (3S)-3,7-diaminoheptanamide.
| Compound Name | (3S)-3,7-diaminoheptanamide |
|---|---|
| PubChem CID | 165481888 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (3S)-3,7-diaminoheptanamide |
| SMILES | NCCCC[C@H](N)CC(N)=O |
| InChI | InChI=1S/C7H17N3O/c8-4-2-1-3-6(9)5-7(10)11/h6H,1-5,8-9H2,(H2,10,11)/t6-/m0/s1 |
| InChIKey | JNQDJLXPWSEYLA-LURJTMIESA-N |
| XLogP | -0.68 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|