About 3-aminoundecanamide
3-aminoundecanamide (PubChem CID 154005326) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-aminoundecanamide.
Molecular Properties
| Compound Name | 3-aminoundecanamide |
| PubChem CID | 154005326 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3-aminoundecanamide |
| SMILES | CCCCCCCCC(N)CC(N)=O |
| InChI | InChI=1S/C11H24N2O/c1-2-3-4-5-6-7-8-10(12)9-11(13)14/h10H,2-9,12H2,1H3,(H2,13,14) |
| InChIKey | KHIQKQQWFUQOFV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminoundecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminoundecanamide?
The IUPAC name of 3-aminoundecanamide (CID 154005326) is 3-aminoundecanamide.
What is the SMILES notation for 3-aminoundecanamide?
The canonical SMILES for 3-aminoundecanamide is CCCCCCCCC(N)CC(N)=O.
What is the InChIKey of 3-aminoundecanamide?
The InChIKey is KHIQKQQWFUQOFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-2-3-4-5-6-7-8-10(12)9-11(13)14/h10H,2-9,12H2,1H3,(H2,13,14).
What are the key properties of 3-aminoundecanamide?
3-aminoundecanamide has a molecular weight of 200.33 g/mol, XLogP of 1.94, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminoundecanamide is sourced from PubChem (CID 154005326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).