About butyl 3-aminooctanoate
butyl 3-aminooctanoate (PubChem CID 87883876) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is butyl 3-aminooctanoate.
Molecular Properties
| Compound Name | butyl 3-aminooctanoate |
| PubChem CID | 87883876 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | butyl 3-aminooctanoate |
| SMILES | CCCCCC(N)CC(=O)OCCCC |
| InChI | InChI=1S/C12H25NO2/c1-3-5-7-8-11(13)10-12(14)15-9-6-4-2/h11H,3-10,13H2,1-2H3 |
| InChIKey | PKRBTJXJZYCICZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-aminooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-aminooctanoate?
The IUPAC name of butyl 3-aminooctanoate (CID 87883876) is butyl 3-aminooctanoate.
What is the SMILES notation for butyl 3-aminooctanoate?
The canonical SMILES for butyl 3-aminooctanoate is CCCCCC(N)CC(=O)OCCCC.
What is the InChIKey of butyl 3-aminooctanoate?
The InChIKey is PKRBTJXJZYCICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-3-5-7-8-11(13)10-12(14)15-9-6-4-2/h11H,3-10,13H2,1-2H3.
What are the key properties of butyl 3-aminooctanoate?
butyl 3-aminooctanoate has a molecular weight of 215.34 g/mol, XLogP of 2.63, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-aminooctanoate is sourced from PubChem (CID 87883876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).