About carbamic acid;undecan-2-amine
carbamic acid;undecan-2-amine (PubChem CID 175209089) has the molecular formula C12H28N2O2
and a molecular weight of 232.37 g/mol. Its IUPAC name is carbamic acid;undecan-2-amine.
Molecular Properties
| Compound Name | carbamic acid;undecan-2-amine |
| PubChem CID | 175209089 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | carbamic acid;undecan-2-amine |
| SMILES | CCCCCCCCCC(C)N.NC(=O)O |
| InChI | InChI=1S/C11H25N.CH3NO2/c1-3-4-5-6-7-8-9-10-11(2)12;2-1(3)4/h11H,3-10,12H2,1-2H3;2H2,(H,3,4) |
| InChIKey | UZCNALWHUQUBFC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;undecan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;undecan-2-amine?
The IUPAC name of carbamic acid;undecan-2-amine (CID 175209089) is carbamic acid;undecan-2-amine.
What is the SMILES notation for carbamic acid;undecan-2-amine?
The canonical SMILES for carbamic acid;undecan-2-amine is CCCCCCCCCC(C)N.NC(=O)O.
What is the InChIKey of carbamic acid;undecan-2-amine?
The InChIKey is UZCNALWHUQUBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N.CH3NO2/c1-3-4-5-6-7-8-9-10-11(2)12;2-1(3)4/h11H,3-10,12H2,1-2H3;2H2,(H,3,4).
What are the key properties of carbamic acid;undecan-2-amine?
carbamic acid;undecan-2-amine has a molecular weight of 232.37 g/mol, XLogP of 3.10, 8 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;undecan-2-amine is sourced from PubChem (CID 175209089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).