About tetradecan-2-amine;hydrobromide
tetradecan-2-amine;hydrobromide (PubChem CID 175070931) has the molecular formula C14H32BrN
and a molecular weight of 294.32 g/mol. Its IUPAC name is tetradecan-2-amine;hydrobromide.
Molecular Properties
| Compound Name | tetradecan-2-amine;hydrobromide |
| PubChem CID | 175070931 |
| Molecular Formula | C14H32BrN |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | tetradecan-2-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCC(C)N |
| InChI | InChI=1S/C14H31N.BrH/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15;/h14H,3-13,15H2,1-2H3;1H |
| InChIKey | OIHGJIFYFARDJP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecan-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecan-2-amine;hydrobromide?
The IUPAC name of tetradecan-2-amine;hydrobromide (CID 175070931) is tetradecan-2-amine;hydrobromide.
What is the SMILES notation for tetradecan-2-amine;hydrobromide?
The canonical SMILES for tetradecan-2-amine;hydrobromide is Br.CCCCCCCCCCCCC(C)N.
What is the InChIKey of tetradecan-2-amine;hydrobromide?
The InChIKey is OIHGJIFYFARDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.BrH/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15;/h14H,3-13,15H2,1-2H3;1H.
What are the key properties of tetradecan-2-amine;hydrobromide?
tetradecan-2-amine;hydrobromide has a molecular weight of 294.32 g/mol, XLogP of 5.22, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecan-2-amine;hydrobromide is sourced from PubChem (CID 175070931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).