About docosane-2,21-diamine
docosane-2,21-diamine (PubChem CID 150079956) has the molecular formula C22H48N2
and a molecular weight of 340.64 g/mol. Its IUPAC name is docosane-2,21-diamine.
Molecular Properties
| Compound Name | docosane-2,21-diamine |
| PubChem CID | 150079956 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | docosane-2,21-diamine |
| SMILES | CC(N)CCCCCCCCCCCCCCCCCCC(C)N |
| InChI | InChI=1S/C22H48N2/c1-21(23)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22(2)24/h21-22H,3-20,23-24H2,1-2H3 |
| InChIKey | DRBDCVYULFAAKD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosane-2,21-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosane-2,21-diamine?
The IUPAC name of docosane-2,21-diamine (CID 150079956) is docosane-2,21-diamine.
What is the SMILES notation for docosane-2,21-diamine?
The canonical SMILES for docosane-2,21-diamine is CC(N)CCCCCCCCCCCCCCCCCCC(C)N.
What is the InChIKey of docosane-2,21-diamine?
The InChIKey is DRBDCVYULFAAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N2/c1-21(23)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22(2)24/h21-22H,3-20,23-24H2,1-2H3.
What are the key properties of docosane-2,21-diamine?
docosane-2,21-diamine has a molecular weight of 340.64 g/mol, XLogP of 6.70, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for docosane-2,21-diamine is sourced from PubChem (CID 150079956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).