About pentadecane-2,6,10,14-tetramine
pentadecane-2,6,10,14-tetramine (PubChem CID 164971565) has the molecular formula C15H36N4
and a molecular weight of 272.48 g/mol. Its IUPAC name is pentadecane-2,6,10,14-tetramine.
Molecular Properties
| Compound Name | pentadecane-2,6,10,14-tetramine |
| PubChem CID | 164971565 |
| Molecular Formula | C15H36N4 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.29 |
| IUPAC Name | pentadecane-2,6,10,14-tetramine |
| SMILES | CC(N)CCCC(N)CCCC(N)CCCC(C)N |
| InChI | InChI=1S/C15H36N4/c1-12(16)6-3-8-14(18)10-5-11-15(19)9-4-7-13(2)17/h12-15H,3-11,16-19H2,1-2H3 |
| InChIKey | DEORNQBWSFOCHO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentadecane-2,6,10,14-tetramine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecane-2,6,10,14-tetramine?
The IUPAC name of pentadecane-2,6,10,14-tetramine (CID 164971565) is pentadecane-2,6,10,14-tetramine.
What is the SMILES notation for pentadecane-2,6,10,14-tetramine?
The canonical SMILES for pentadecane-2,6,10,14-tetramine is CC(N)CCCC(N)CCCC(N)CCCC(C)N.
What is the InChIKey of pentadecane-2,6,10,14-tetramine?
The InChIKey is DEORNQBWSFOCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H36N4/c1-12(16)6-3-8-14(18)10-5-11-15(19)9-4-7-13(2)17/h12-15H,3-11,16-19H2,1-2H3.
What are the key properties of pentadecane-2,6,10,14-tetramine?
pentadecane-2,6,10,14-tetramine has a molecular weight of 272.48 g/mol, XLogP of 1.85, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecane-2,6,10,14-tetramine is sourced from PubChem (CID 164971565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).