C15H36N4 — CID 164971565
pentadecane-2,6,10,14-tetramine (PubChem CID 164971565) has the molecular formula C15H36N4 and a molecular weight of 272.48 g/mol. Its IUPAC name is pentadecane-2,6,10,14-tetramine.
| Compound Name | pentadecane-2,6,10,14-tetramine |
|---|---|
| PubChem CID | 164971565 |
| Molecular Formula | C15H36N4 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.29 |
| IUPAC Name | pentadecane-2,6,10,14-tetramine |
| SMILES | CC(N)CCCC(N)CCCC(N)CCCC(C)N |
| InChI | InChI=1S/C15H36N4/c1-12(16)6-3-8-14(18)10-5-11-15(19)9-4-7-13(2)17/h12-15H,3-11,16-19H2,1-2H3 |
| InChIKey | DEORNQBWSFOCHO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |