About 4-aminopentane-1-thiol;ethane
4-aminopentane-1-thiol;ethane (PubChem CID 142392337) has the molecular formula C9H25NS
and a molecular weight of 179.37 g/mol. Its IUPAC name is 4-aminopentane-1-thiol;ethane.
Molecular Properties
| Compound Name | 4-aminopentane-1-thiol;ethane |
| PubChem CID | 142392337 |
| Molecular Formula | C9H25NS |
| Molecular Weight | 179.37 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-aminopentane-1-thiol;ethane |
| SMILES | CC.CC.CC(N)CCCS |
| InChI | InChI=1S/C5H13NS.2C2H6/c1-5(6)3-2-4-7;2*1-2/h5,7H,2-4,6H2,1H3;2*1-2H3 |
| InChIKey | TYUBELMDBGRZSA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminopentane-1-thiol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopentane-1-thiol;ethane?
The IUPAC name of 4-aminopentane-1-thiol;ethane (CID 142392337) is 4-aminopentane-1-thiol;ethane.
What is the SMILES notation for 4-aminopentane-1-thiol;ethane?
The canonical SMILES for 4-aminopentane-1-thiol;ethane is CC.CC.CC(N)CCCS.
What is the InChIKey of 4-aminopentane-1-thiol;ethane?
The InChIKey is TYUBELMDBGRZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS.2C2H6/c1-5(6)3-2-4-7;2*1-2/h5,7H,2-4,6H2,1H3;2*1-2H3.
What are the key properties of 4-aminopentane-1-thiol;ethane?
4-aminopentane-1-thiol;ethane has a molecular weight of 179.37 g/mol, XLogP of 3.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopentane-1-thiol;ethane is sourced from PubChem (CID 142392337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).