About 4-fluoropentane-1-thiol
4-fluoropentane-1-thiol (PubChem CID 87282782) has the molecular formula C5H11FS
and a molecular weight of 122.21 g/mol. Its IUPAC name is 4-fluoropentane-1-thiol.
Molecular Properties
| Compound Name | 4-fluoropentane-1-thiol |
| PubChem CID | 87282782 |
| Molecular Formula | C5H11FS |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 4-fluoropentane-1-thiol |
| SMILES | CC(F)CCCS |
| InChI | InChI=1S/C5H11FS/c1-5(6)3-2-4-7/h5,7H,2-4H2,1H3 |
| InChIKey | DIVZJOFHZIUZKA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoropentane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropentane-1-thiol?
The IUPAC name of 4-fluoropentane-1-thiol (CID 87282782) is 4-fluoropentane-1-thiol.
What is the SMILES notation for 4-fluoropentane-1-thiol?
The canonical SMILES for 4-fluoropentane-1-thiol is CC(F)CCCS.
What is the InChIKey of 4-fluoropentane-1-thiol?
The InChIKey is DIVZJOFHZIUZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11FS/c1-5(6)3-2-4-7/h5,7H,2-4H2,1H3.
What are the key properties of 4-fluoropentane-1-thiol?
4-fluoropentane-1-thiol has a molecular weight of 122.21 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropentane-1-thiol is sourced from PubChem (CID 87282782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).