About 3-propyloctanamide
3-propyloctanamide (PubChem CID 87886173) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 3-propyloctanamide.
Molecular Properties
| Compound Name | 3-propyloctanamide |
| PubChem CID | 87886173 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 3-propyloctanamide |
| SMILES | CCCCCC(CCC)CC(N)=O |
| InChI | InChI=1S/C11H23NO/c1-3-5-6-8-10(7-4-2)9-11(12)13/h10H,3-9H2,1-2H3,(H2,12,13) |
| InChIKey | UVMZQMIROXHJRY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyloctanamide?
The IUPAC name of 3-propyloctanamide (CID 87886173) is 3-propyloctanamide.
What is the SMILES notation for 3-propyloctanamide?
The canonical SMILES for 3-propyloctanamide is CCCCCC(CCC)CC(N)=O.
What is the InChIKey of 3-propyloctanamide?
The InChIKey is UVMZQMIROXHJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-3-5-6-8-10(7-4-2)9-11(12)13/h10H,3-9H2,1-2H3,(H2,12,13).
What are the key properties of 3-propyloctanamide?
3-propyloctanamide has a molecular weight of 185.31 g/mol, XLogP of 2.86, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyloctanamide is sourced from PubChem (CID 87886173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).