About 4-hexyldecanamide
4-hexyldecanamide (PubChem CID 129239397) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is 4-hexyldecanamide.
Molecular Properties
| Compound Name | 4-hexyldecanamide |
| PubChem CID | 129239397 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 4-hexyldecanamide |
| SMILES | CCCCCCC(CCCCCC)CCC(N)=O |
| InChI | InChI=1S/C16H33NO/c1-3-5-7-9-11-15(13-14-16(17)18)12-10-8-6-4-2/h15H,3-14H2,1-2H3,(H2,17,18) |
| InChIKey | QHOHFSXKXWAQTN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyldecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyldecanamide?
The IUPAC name of 4-hexyldecanamide (CID 129239397) is 4-hexyldecanamide.
What is the SMILES notation for 4-hexyldecanamide?
The canonical SMILES for 4-hexyldecanamide is CCCCCCC(CCCCCC)CCC(N)=O.
What is the InChIKey of 4-hexyldecanamide?
The InChIKey is QHOHFSXKXWAQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-3-5-7-9-11-15(13-14-16(17)18)12-10-8-6-4-2/h15H,3-14H2,1-2H3,(H2,17,18).
What are the key properties of 4-hexyldecanamide?
4-hexyldecanamide has a molecular weight of 255.45 g/mol, XLogP of 4.81, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyldecanamide is sourced from PubChem (CID 129239397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).