C42H80N2O2 — CID 141048473
(9Z,28Z)-19-pentylheptatriaconta-9,28-dienediamide (PubChem CID 141048473) has the molecular formula C42H80N2O2 and a molecular weight of 645.11 g/mol. Its IUPAC name is (9Z,28Z)-19-pentylheptatriaconta-9,28-dienediamide.
| Compound Name | (9Z,28Z)-19-pentylheptatriaconta-9,28-dienediamide |
|---|---|
| PubChem CID | 141048473 |
| Molecular Formula | C42H80N2O2 |
| Molecular Weight | 645.11 g/mol |
| Exact Mass | 644.62 |
| IUPAC Name | (9Z,28Z)-19-pentylheptatriaconta-9,28-dienediamide |
| SMILES | CCCCCC(CCCCCCCC/C=C\CCCCCCCC(N)=O)CCCCCCCC/C=C\CCCCCCCC(N)=O |
| InChI | InChI=1S/C42H80N2O2/c1-2-3-30-35-40(36-31-26-22-18-14-10-6-4-8-12-16-20-24-28-33-38-41(43)45)37-32-27-23-19-15-11-7-5-9-13-17-21-25-29-34-39-42(44)46/h4-5,8-9,40H,2-3,6-7,10-39H2,1H3,(H2,43,45)(H2,44,46)/b8-4-,9-5- |
| InChIKey | ZMXREFHNYHRIOA-XEQVNJCQSA-N |
| XLogP | 12.97 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.11 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|