About 5-hydroxyoctadecanamide
5-hydroxyoctadecanamide (PubChem CID 23176537) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 5-hydroxyoctadecanamide.
Molecular Properties
| Compound Name | 5-hydroxyoctadecanamide |
| PubChem CID | 23176537 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 5-hydroxyoctadecanamide |
| SMILES | CCCCCCCCCCCCCC(O)CCCC(N)=O |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(20)15-13-16-18(19)21/h17,20H,2-16H2,1H3,(H2,19,21) |
| InChIKey | YZYLRMUZVBTMMS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyoctadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyoctadecanamide?
The IUPAC name of 5-hydroxyoctadecanamide (CID 23176537) is 5-hydroxyoctadecanamide.
What is the SMILES notation for 5-hydroxyoctadecanamide?
The canonical SMILES for 5-hydroxyoctadecanamide is CCCCCCCCCCCCCC(O)CCCC(N)=O.
What is the InChIKey of 5-hydroxyoctadecanamide?
The InChIKey is YZYLRMUZVBTMMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(20)15-13-16-18(19)21/h17,20H,2-16H2,1H3,(H2,19,21).
What are the key properties of 5-hydroxyoctadecanamide?
5-hydroxyoctadecanamide has a molecular weight of 299.50 g/mol, XLogP of 4.70, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyoctadecanamide is sourced from PubChem (CID 23176537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).