C4H11N3O — CID 66426891
3,4-diaminobutanamide (PubChem CID 66426891) has the molecular formula C4H11N3O and a molecular weight of 117.15 g/mol. Its IUPAC name is 3,4-diaminobutanamide.
| Compound Name | 3,4-diaminobutanamide |
|---|---|
| PubChem CID | 66426891 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | 3,4-diaminobutanamide |
| SMILES | NCC(N)CC(N)=O |
| InChI | InChI=1S/C4H11N3O/c5-2-3(6)1-4(7)8/h3H,1-2,5-6H2,(H2,7,8) |
| InChIKey | PCNYNMLBCLAPAV-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |