C6H15N3O — CID 163484084
5,6-diaminohexanamide (PubChem CID 163484084) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 5,6-diaminohexanamide.
| Compound Name | 5,6-diaminohexanamide |
|---|---|
| PubChem CID | 163484084 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 5,6-diaminohexanamide |
| SMILES | NCC(N)CCCC(N)=O |
| InChI | InChI=1S/C6H15N3O/c7-4-5(8)2-1-3-6(9)10/h5H,1-4,7-8H2,(H2,9,10) |
| InChIKey | CHBDBYHDWWMWKU-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |