C8H14O2 — CID 131236706
(E,7R)-7-hydroxyoct-2-enal (PubChem CID 131236706) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (E,7R)-7-hydroxyoct-2-enal.
| Compound Name | (E,7R)-7-hydroxyoct-2-enal |
|---|---|
| PubChem CID | 131236706 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (E,7R)-7-hydroxyoct-2-enal |
| SMILES | C[C@@H](O)CCC/C=C/C=O |
| InChI | InChI=1S/C8H14O2/c1-8(10)6-4-2-3-5-7-9/h3,5,7-8,10H,2,4,6H2,1H3/b5-3+/t8-/m1/s1 |
| InChIKey | VZCDGNFDWNEPMU-RYEJSQLPSA-N |
| XLogP | 1.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|