C9H16O3 — CID 121360685
8,9-dihydroxynon-2-enal (PubChem CID 121360685) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 8,9-dihydroxynon-2-enal.
| Compound Name | 8,9-dihydroxynon-2-enal |
|---|---|
| PubChem CID | 121360685 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 8,9-dihydroxynon-2-enal |
| SMILES | O=CC=CCCCCC(O)CO |
| InChI | InChI=1S/C9H16O3/c10-7-5-3-1-2-4-6-9(12)8-11/h3,5,7,9,11-12H,1-2,4,6,8H2 |
| InChIKey | HTUFNWKDEJLCPM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|