C17H32O3 — CID 38363735
(2S,4R,14E)-heptadeca-14,16-diene-1,2,4-triol (PubChem CID 38363735) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is (2S,4R,14E)-heptadeca-14,16-diene-1,2,4-triol.
| Compound Name | (2S,4R,14E)-heptadeca-14,16-diene-1,2,4-triol |
|---|---|
| PubChem CID | 38363735 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | (2S,4R,14E)-heptadeca-14,16-diene-1,2,4-triol |
| SMILES | C=C/C=C/CCCCCCCCC[C@@H](O)C[C@H](O)CO |
| InChI | InChI=1S/C17H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(19)14-17(20)15-18/h2-4,16-20H,1,5-15H2/b4-3+/t16-,17+/m1/s1 |
| InChIKey | PHNKLLIMYYNUMV-YRLOJYSSSA-N |
| XLogP | 3.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|