C13H24 — CID 154156925
11-methyldodeca-1,3-diene (PubChem CID 154156925) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is 11-methyldodeca-1,3-diene.
| Compound Name | 11-methyldodeca-1,3-diene |
|---|---|
| PubChem CID | 154156925 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 11-methyldodeca-1,3-diene |
| SMILES | C=CC=CCCCCCCC(C)C |
| InChI | InChI=1S/C13H24/c1-4-5-6-7-8-9-10-11-12-13(2)3/h4-6,13H,1,7-12H2,2-3H3 |
| InChIKey | VODJBQPOBZCEBN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|