C12H22O2 — CID 163205940
(3Z)-10,10-dimethoxydeca-1,3-diene (PubChem CID 163205940) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (3Z)-10,10-dimethoxydeca-1,3-diene.
| Compound Name | (3Z)-10,10-dimethoxydeca-1,3-diene |
|---|---|
| PubChem CID | 163205940 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (3Z)-10,10-dimethoxydeca-1,3-diene |
| SMILES | C=C/C=C\CCCCCC(OC)OC |
| InChI | InChI=1S/C12H22O2/c1-4-5-6-7-8-9-10-11-12(13-2)14-3/h4-6,12H,1,7-11H2,2-3H3/b6-5- |
| InChIKey | FFDUARDFNOGSEY-WAYWQWQTSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|