C17H33IO2 — CID 163205538
(E)-1-iodo-15,15-dimethoxypentadec-3-ene (PubChem CID 163205538) has the molecular formula C17H33IO2 and a molecular weight of 396.35 g/mol. Its IUPAC name is (E)-1-iodo-15,15-dimethoxypentadec-3-ene.
| Compound Name | (E)-1-iodo-15,15-dimethoxypentadec-3-ene |
|---|---|
| PubChem CID | 163205538 |
| Molecular Formula | C17H33IO2 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-1-iodo-15,15-dimethoxypentadec-3-ene |
| SMILES | COC(CCCCCCCCCC/C=C/CCI)OC |
| InChI | InChI=1S/C17H33IO2/c1-19-17(20-2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18/h10,12,17H,3-9,11,13-16H2,1-2H3/b12-10+ |
| InChIKey | MLGGAMSJCGARJH-ZRDIBKRKSA-N |
| XLogP | 5.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|