C18H36O2 — CID 6438015
(Z)-16,16-dimethoxyhexadec-7-ene (PubChem CID 6438015) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is (Z)-16,16-dimethoxyhexadec-7-ene.
| Compound Name | (Z)-16,16-dimethoxyhexadec-7-ene |
|---|---|
| PubChem CID | 6438015 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | (Z)-16,16-dimethoxyhexadec-7-ene |
| SMILES | CCCCCC/C=C\CCCCCCCC(OC)OC |
| InChI | InChI=1S/C18H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19-2)20-3/h9-10,18H,4-8,11-17H2,1-3H3/b10-9- |
| InChIKey | HPVRSOHMDHUDAZ-KTKRTIGZSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|