C20H39BrO2 — CID 163205986
(Z)-1-bromo-18,18-dimethoxyoctadec-3-ene (PubChem CID 163205986) has the molecular formula C20H39BrO2 and a molecular weight of 391.43 g/mol. Its IUPAC name is (Z)-1-bromo-18,18-dimethoxyoctadec-3-ene.
| Compound Name | (Z)-1-bromo-18,18-dimethoxyoctadec-3-ene |
|---|---|
| PubChem CID | 163205986 |
| Molecular Formula | C20H39BrO2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (Z)-1-bromo-18,18-dimethoxyoctadec-3-ene |
| SMILES | COC(CCCCCCCCCCCCC/C=C\CCBr)OC |
| InChI | InChI=1S/C20H39BrO2/c1-22-20(23-2)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21/h13,15,20H,3-12,14,16-19H2,1-2H3/b15-13- |
| InChIKey | IUCTXZHDEVCKOR-SQFISAMPSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|