C19H38O2 — CID 6450378
(E,14R)-1,1-dimethoxy-14-methylhexadec-8-ene (PubChem CID 6450378) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is (E,14R)-1,1-dimethoxy-14-methylhexadec-8-ene.
| Compound Name | (E,14R)-1,1-dimethoxy-14-methylhexadec-8-ene |
|---|---|
| PubChem CID | 6450378 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | (E,14R)-1,1-dimethoxy-14-methylhexadec-8-ene |
| SMILES | CC[C@@H](C)CCCC/C=C/CCCCCCC(OC)OC |
| InChI | InChI=1S/C19H38O2/c1-5-18(2)16-14-12-10-8-6-7-9-11-13-15-17-19(20-3)21-4/h6,8,18-19H,5,7,9-17H2,1-4H3/b8-6+/t18-/m1/s1 |
| InChIKey | CBKICWXFWKPHNL-JHTBKMLMSA-N |
| XLogP | 6.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|