C18H35BrO2 — CID 163205542
(E)-1-bromo-16,16-dimethoxyhexadec-3-ene (PubChem CID 163205542) has the molecular formula C18H35BrO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is (E)-1-bromo-16,16-dimethoxyhexadec-3-ene.
| Compound Name | (E)-1-bromo-16,16-dimethoxyhexadec-3-ene |
|---|---|
| PubChem CID | 163205542 |
| Molecular Formula | C18H35BrO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (E)-1-bromo-16,16-dimethoxyhexadec-3-ene |
| SMILES | COC(CCCCCCCCCCC/C=C/CCBr)OC |
| InChI | InChI=1S/C18H35BrO2/c1-20-18(21-2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h11,13,18H,3-10,12,14-17H2,1-2H3/b13-11+ |
| InChIKey | MZIOOVPQQXYHSX-ACCUITESSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|