C13H25ClO2 — CID 165174939
1-chloro-11,11-dimethoxyundec-4-ene (PubChem CID 165174939) has the molecular formula C13H25ClO2 and a molecular weight of 248.79 g/mol. Its IUPAC name is 1-chloro-11,11-dimethoxyundec-4-ene.
| Compound Name | 1-chloro-11,11-dimethoxyundec-4-ene |
|---|---|
| PubChem CID | 165174939 |
| Molecular Formula | C13H25ClO2 |
| Molecular Weight | 248.79 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-chloro-11,11-dimethoxyundec-4-ene |
| SMILES | COC(CCCCCC=CCCCCl)OC |
| InChI | InChI=1S/C13H25ClO2/c1-15-13(16-2)11-9-7-5-3-4-6-8-10-12-14/h4,6,13H,3,5,7-12H2,1-2H3 |
| InChIKey | XIHIEOCQMRVBPK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|