C15H28O2 — CID 13111838
(3E)-13,13-dimethoxytrideca-1,3-diene (PubChem CID 13111838) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3E)-13,13-dimethoxytrideca-1,3-diene.
| Compound Name | (3E)-13,13-dimethoxytrideca-1,3-diene |
|---|---|
| PubChem CID | 13111838 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3E)-13,13-dimethoxytrideca-1,3-diene |
| SMILES | C=C/C=C/CCCCCCCCC(OC)OC |
| InChI | InChI=1S/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-14-15(16-2)17-3/h4-6,15H,1,7-14H2,2-3H3/b6-5+ |
| InChIKey | YHPHYWBXFJMHRI-AATRIKPKSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|