C20H38O2 — CID 163205499
(3E)-12,12-dibutoxydodeca-1,3-diene (PubChem CID 163205499) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (3E)-12,12-dibutoxydodeca-1,3-diene.
| Compound Name | (3E)-12,12-dibutoxydodeca-1,3-diene |
|---|---|
| PubChem CID | 163205499 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (3E)-12,12-dibutoxydodeca-1,3-diene |
| SMILES | C=C/C=C/CCCCCCCC(OCCCC)OCCCC |
| InChI | InChI=1S/C20H38O2/c1-4-7-10-11-12-13-14-15-16-17-20(21-18-8-5-2)22-19-9-6-3/h4,7,10,20H,1,5-6,8-9,11-19H2,2-3H3/b10-7+ |
| InChIKey | UROJTWQWPDJKOT-JXMROGBWSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|