C42H78O3 — CID 162350463
(5Z,7E)-13-octoxy-13-[(6E,8Z)-1-octoxytrideca-6,8-dienoxy]trideca-5,7-diene (PubChem CID 162350463) has the molecular formula C42H78O3 and a molecular weight of 631.08 g/mol. Its IUPAC name is (5Z,7E)-13-octoxy-13-[(6E,8Z)-1-octoxytrideca-6,8-dienoxy]trideca-5,7-diene.
| Compound Name | (5Z,7E)-13-octoxy-13-[(6E,8Z)-1-octoxytrideca-6,8-dienoxy]trideca-5,7-diene |
|---|---|
| PubChem CID | 162350463 |
| Molecular Formula | C42H78O3 |
| Molecular Weight | 631.08 g/mol |
| Exact Mass | 630.60 |
| IUPAC Name | (5Z,7E)-13-octoxy-13-[(6E,8Z)-1-octoxytrideca-6,8-dienoxy]trideca-5,7-diene |
| SMILES | CCCC/C=C\C=C\CCCCC(OCCCCCCCC)OC(CCCC/C=C/C=C\CCCC)OCCCCCCCC |
| InChI | InChI=1S/C42H78O3/c1-5-9-13-17-21-23-25-27-29-33-37-41(43-39-35-31-19-15-11-7-3)45-42(44-40-36-32-20-16-12-8-4)38-34-30-28-26-24-22-18-14-10-6-2/h17-18,21-26,41-42H,5-16,19-20,27-40H2,1-4H3/b21-17-,22-18-,25-23+,26-24+ |
| InChIKey | ZPBHFAVJJJZHDF-KZZXUPGNSA-N |
| XLogP | 14.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.08 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|