C30H54O3 — CID 162350331
(5Z,7E)-13-ethoxy-13-[(6E,8Z)-1-ethoxytrideca-6,8-dienoxy]trideca-5,7-diene (PubChem CID 162350331) has the molecular formula C30H54O3 and a molecular weight of 462.76 g/mol. Its IUPAC name is (5Z,7E)-13-ethoxy-13-[(6E,8Z)-1-ethoxytrideca-6,8-dienoxy]trideca-5,7-diene.
| Compound Name | (5Z,7E)-13-ethoxy-13-[(6E,8Z)-1-ethoxytrideca-6,8-dienoxy]trideca-5,7-diene |
|---|---|
| PubChem CID | 162350331 |
| Molecular Formula | C30H54O3 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.41 |
| IUPAC Name | (5Z,7E)-13-ethoxy-13-[(6E,8Z)-1-ethoxytrideca-6,8-dienoxy]trideca-5,7-diene |
| SMILES | CCCC/C=C\C=C\CCCCC(OCC)OC(CCCC/C=C/C=C\CCCC)OCC |
| InChI | InChI=1S/C30H54O3/c1-5-9-11-13-15-17-19-21-23-25-27-29(31-7-3)33-30(32-8-4)28-26-24-22-20-18-16-14-12-10-6-2/h13-20,29-30H,5-12,21-28H2,1-4H3/b15-13-,16-14-,19-17+,20-18+ |
| InChIKey | GRKNQTABBSHRAC-CLAJRUQZSA-N |
| XLogP | 9.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|