C22H42O2 — CID 146189754
(5Z,7E)-16,16-dipropoxyhexadeca-5,7-diene (PubChem CID 146189754) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is (5Z,7E)-16,16-dipropoxyhexadeca-5,7-diene.
| Compound Name | (5Z,7E)-16,16-dipropoxyhexadeca-5,7-diene |
|---|---|
| PubChem CID | 146189754 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | (5Z,7E)-16,16-dipropoxyhexadeca-5,7-diene |
| SMILES | CCCC/C=C\C=C\CCCCCCCC(OCCC)OCCC |
| InChI | InChI=1S/C22H42O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23-20-5-2)24-21-6-3/h9-12,22H,4-8,13-21H2,1-3H3/b10-9-,12-11+ |
| InChIKey | YYWUXAYEZYAUHQ-XAZJVICWSA-N |
| XLogP | 7.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|